About 1H-pyrrolo[2,3-d]imidazol-5-imine
1H-pyrrolo[2,3-d]imidazol-5-imine (PubChem CID 141120776) has the molecular formula C5H4N4
and a molecular weight of 120.11 g/mol. Its IUPAC name is 1H-pyrrolo[2,3-d]imidazol-5-imine.
Molecular Properties
| Compound Name | 1H-pyrrolo[2,3-d]imidazol-5-imine |
| PubChem CID | 141120776 |
| Molecular Formula | C5H4N4 |
| Molecular Weight | 120.11 g/mol |
| Exact Mass | 120.04 |
| IUPAC Name | 1H-pyrrolo[2,3-d]imidazol-5-imine |
| SMILES | [H]/N=C1/C=c2[nH]cnc2=N1 |
| InChI | InChI=1S/C5H4N4/c6-4-1-3-5(9-4)8-2-7-3/h1-2H,(H2,6,7,8,9) |
| InChIKey | DCBPXKUEPACHAY-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 64.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.11 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyrrolo[2,3-d]imidazol-5-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrolo[2,3-d]imidazol-5-imine?
The IUPAC name of 1H-pyrrolo[2,3-d]imidazol-5-imine (CID 141120776) is 1H-pyrrolo[2,3-d]imidazol-5-imine.
What is the SMILES notation for 1H-pyrrolo[2,3-d]imidazol-5-imine?
The canonical SMILES for 1H-pyrrolo[2,3-d]imidazol-5-imine is [H]/N=C1/C=c2[nH]cnc2=N1.
What is the InChIKey of 1H-pyrrolo[2,3-d]imidazol-5-imine?
The InChIKey is DCBPXKUEPACHAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4/c6-4-1-3-5(9-4)8-2-7-3/h1-2H,(H2,6,7,8,9).
What are the key properties of 1H-pyrrolo[2,3-d]imidazol-5-imine?
1H-pyrrolo[2,3-d]imidazol-5-imine has a molecular weight of 120.11 g/mol, XLogP of -1.20, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrolo[2,3-d]imidazol-5-imine is sourced from PubChem (CID 141120776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).