About 2-(2-butylheptyl)-1,3-dioxole
2-(2-butylheptyl)-1,3-dioxole (PubChem CID 141121489) has the molecular formula C14H26O2
and a molecular weight of 226.36 g/mol. Its IUPAC name is 2-(2-butylheptyl)-1,3-dioxole.
Molecular Properties
| Compound Name | 2-(2-butylheptyl)-1,3-dioxole |
| PubChem CID | 141121489 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 2-(2-butylheptyl)-1,3-dioxole |
| SMILES | CCCCCC(CCCC)CC1OC=CO1 |
| InChI | InChI=1S/C14H26O2/c1-3-5-7-9-13(8-6-4-2)12-14-15-10-11-16-14/h10-11,13-14H,3-9,12H2,1-2H3 |
| InChIKey | MDPSOZAFXFITSW-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-butylheptyl)-1,3-dioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-butylheptyl)-1,3-dioxole?
The IUPAC name of 2-(2-butylheptyl)-1,3-dioxole (CID 141121489) is 2-(2-butylheptyl)-1,3-dioxole.
What is the SMILES notation for 2-(2-butylheptyl)-1,3-dioxole?
The canonical SMILES for 2-(2-butylheptyl)-1,3-dioxole is CCCCCC(CCCC)CC1OC=CO1.
What is the InChIKey of 2-(2-butylheptyl)-1,3-dioxole?
The InChIKey is MDPSOZAFXFITSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O2/c1-3-5-7-9-13(8-6-4-2)12-14-15-10-11-16-14/h10-11,13-14H,3-9,12H2,1-2H3.
What are the key properties of 2-(2-butylheptyl)-1,3-dioxole?
2-(2-butylheptyl)-1,3-dioxole has a molecular weight of 226.36 g/mol, XLogP of 4.61, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-butylheptyl)-1,3-dioxole is sourced from PubChem (CID 141121489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).