About 2-(1-adamantylamino)-7,7-dimethyl-6,8-dihydroquinolin-5-one
2-(1-adamantylamino)-7,7-dimethyl-6,8-dihydroquinolin-5-one (PubChem CID 141121622) has the molecular formula C21H28N2O
and a molecular weight of 324.47 g/mol. Its IUPAC name is 2-(1-adamantylamino)-7,7-dimethyl-6,8-dihydroquinolin-5-one.
Molecular Properties
| Compound Name | 2-(1-adamantylamino)-7,7-dimethyl-6,8-dihydroquinolin-5-one |
| PubChem CID | 141121622 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 2-(1-adamantylamino)-7,7-dimethyl-6,8-dihydroquinolin-5-one |
| SMILES | CC1(C)CC(=O)c2ccc(NC34CC5CC(CC(C5)C3)C4)nc2C1 |
| InChI | InChI=1S/C21H28N2O/c1-20(2)11-17-16(18(24)12-20)3-4-19(22-17)23-21-8-13-5-14(9-21)7-15(6-13)10-21/h3-4,13-15H,5-12H2,1-2H3,(H,22,23) |
| InChIKey | DUCKIHWSCYCMAI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-adamantylamino)-7,7-dimethyl-6,8-dihydroquinolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-adamantylamino)-7,7-dimethyl-6,8-dihydroquinolin-5-one?
The IUPAC name of 2-(1-adamantylamino)-7,7-dimethyl-6,8-dihydroquinolin-5-one (CID 141121622) is 2-(1-adamantylamino)-7,7-dimethyl-6,8-dihydroquinolin-5-one.
What is the SMILES notation for 2-(1-adamantylamino)-7,7-dimethyl-6,8-dihydroquinolin-5-one?
The canonical SMILES for 2-(1-adamantylamino)-7,7-dimethyl-6,8-dihydroquinolin-5-one is CC1(C)CC(=O)c2ccc(NC34CC5CC(CC(C5)C3)C4)nc2C1.
What is the InChIKey of 2-(1-adamantylamino)-7,7-dimethyl-6,8-dihydroquinolin-5-one?
The InChIKey is DUCKIHWSCYCMAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N2O/c1-20(2)11-17-16(18(24)12-20)3-4-19(22-17)23-21-8-13-5-14(9-21)7-15(6-13)10-21/h3-4,13-15H,5-12H2,1-2H3,(H,22,23).
What are the key properties of 2-(1-adamantylamino)-7,7-dimethyl-6,8-dihydroquinolin-5-one?
2-(1-adamantylamino)-7,7-dimethyl-6,8-dihydroquinolin-5-one has a molecular weight of 324.47 g/mol, XLogP of 4.62, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-adamantylamino)-7,7-dimethyl-6,8-dihydroquinolin-5-one is sourced from PubChem (CID 141121622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).