About 7,7-dimethyl-3-nitro-2-(4-phenylpiperazin-1-yl)-6,8-dihydro-5H-quinoline
7,7-dimethyl-3-nitro-2-(4-phenylpiperazin-1-yl)-6,8-dihydro-5H-quinoline (PubChem CID 141121643) has the molecular formula C21H26N4O2
and a molecular weight of 366.47 g/mol. Its IUPAC name is 7,7-dimethyl-3-nitro-2-(4-phenylpiperazin-1-yl)-6,8-dihydro-5H-quinoline.
Molecular Properties
| Compound Name | 7,7-dimethyl-3-nitro-2-(4-phenylpiperazin-1-yl)-6,8-dihydro-5H-quinoline |
| PubChem CID | 141121643 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 7,7-dimethyl-3-nitro-2-(4-phenylpiperazin-1-yl)-6,8-dihydro-5H-quinoline |
| SMILES | CC1(C)CCc2cc([N+](=O)[O-])c(N3CCN(c4ccccc4)CC3)nc2C1 |
| InChI | InChI=1S/C21H26N4O2/c1-21(2)9-8-16-14-19(25(26)27)20(22-18(16)15-21)24-12-10-23(11-13-24)17-6-4-3-5-7-17/h3-7,14H,8-13,15H2,1-2H3 |
| InChIKey | OAJDBDGCZAAIHV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 62.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7,7-dimethyl-3-nitro-2-(4-phenylpiperazin-1-yl)-6,8-dihydro-5H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dimethyl-3-nitro-2-(4-phenylpiperazin-1-yl)-6,8-dihydro-5H-quinoline?
The IUPAC name of 7,7-dimethyl-3-nitro-2-(4-phenylpiperazin-1-yl)-6,8-dihydro-5H-quinoline (CID 141121643) is 7,7-dimethyl-3-nitro-2-(4-phenylpiperazin-1-yl)-6,8-dihydro-5H-quinoline.
What is the SMILES notation for 7,7-dimethyl-3-nitro-2-(4-phenylpiperazin-1-yl)-6,8-dihydro-5H-quinoline?
The canonical SMILES for 7,7-dimethyl-3-nitro-2-(4-phenylpiperazin-1-yl)-6,8-dihydro-5H-quinoline is CC1(C)CCc2cc([N+](=O)[O-])c(N3CCN(c4ccccc4)CC3)nc2C1.
What is the InChIKey of 7,7-dimethyl-3-nitro-2-(4-phenylpiperazin-1-yl)-6,8-dihydro-5H-quinoline?
The InChIKey is OAJDBDGCZAAIHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4O2/c1-21(2)9-8-16-14-19(25(26)27)20(22-18(16)15-21)24-12-10-23(11-13-24)17-6-4-3-5-7-17/h3-7,14H,8-13,15H2,1-2H3.
What are the key properties of 7,7-dimethyl-3-nitro-2-(4-phenylpiperazin-1-yl)-6,8-dihydro-5H-quinoline?
7,7-dimethyl-3-nitro-2-(4-phenylpiperazin-1-yl)-6,8-dihydro-5H-quinoline has a molecular weight of 366.47 g/mol, XLogP of 3.83, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dimethyl-3-nitro-2-(4-phenylpiperazin-1-yl)-6,8-dihydro-5H-quinoline is sourced from PubChem (CID 141121643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).