C20H28N2O3 — CID 141122386
3-[4-(2,2-dimethyl-1,3-dioxan-5-yl)butyl]-2-ethylquinazolin-4-one (PubChem CID 141122386) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 3-[4-(2,2-dimethyl-1,3-dioxan-5-yl)butyl]-2-ethylquinazolin-4-one.
| Compound Name | 3-[4-(2,2-dimethyl-1,3-dioxan-5-yl)butyl]-2-ethylquinazolin-4-one |
|---|---|
| PubChem CID | 141122386 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 3-[4-(2,2-dimethyl-1,3-dioxan-5-yl)butyl]-2-ethylquinazolin-4-one |
| SMILES | CCc1nc2ccccc2c(=O)n1CCCCC1COC(C)(C)OC1 |
| InChI | InChI=1S/C20H28N2O3/c1-4-18-21-17-11-6-5-10-16(17)19(23)22(18)12-8-7-9-15-13-24-20(2,3)25-14-15/h5-6,10-11,15H,4,7-9,12-14H2,1-3H3 |
| InChIKey | WRLIASSQOQOKRQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|