C14H18Br2O3 — CID 141122399
tert-butyl 2,6-dibromo-4-methoxy-3,5-dimethylbenzoate (PubChem CID 141122399) has the molecular formula C14H18Br2O3 and a molecular weight of 394.10 g/mol. Its IUPAC name is tert-butyl 2,6-dibromo-4-methoxy-3,5-dimethylbenzoate.
| Compound Name | tert-butyl 2,6-dibromo-4-methoxy-3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 141122399 |
| Molecular Formula | C14H18Br2O3 |
| Molecular Weight | 394.10 g/mol |
| Exact Mass | 391.96 |
| IUPAC Name | tert-butyl 2,6-dibromo-4-methoxy-3,5-dimethylbenzoate |
| SMILES | COc1c(C)c(Br)c(C(=O)OC(C)(C)C)c(Br)c1C |
| InChI | InChI=1S/C14H18Br2O3/c1-7-10(15)9(13(17)19-14(3,4)5)11(16)8(2)12(7)18-6/h1-6H3 |
| InChIKey | VBIHFFCWVPOEGA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.10 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |