C11H13F7O2 — CID 141123056
2,2,2-trifluoro-1-[2-(2,2,3,3-tetrafluoropropoxy)cyclohexyl]ethanone (PubChem CID 141123056) has the molecular formula C11H13F7O2 and a molecular weight of 310.21 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[2-(2,2,3,3-tetrafluoropropoxy)cyclohexyl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[2-(2,2,3,3-tetrafluoropropoxy)cyclohexyl]ethanone |
|---|---|
| PubChem CID | 141123056 |
| Molecular Formula | C11H13F7O2 |
| Molecular Weight | 310.21 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2,2,2-trifluoro-1-[2-(2,2,3,3-tetrafluoropropoxy)cyclohexyl]ethanone |
| SMILES | O=C(C1CCCCC1OCC(F)(F)C(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H13F7O2/c12-9(13)10(14,15)5-20-7-4-2-1-3-6(7)8(19)11(16,17)18/h6-7,9H,1-5H2 |
| InChIKey | PACVEJRUGSXSGP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.21 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|