C14H19NO2 — CID 141123603
6-cyclohexyl-1,3,4,7-tetrahydropyrano[3,4-c]pyridin-8-one (PubChem CID 141123603) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 6-cyclohexyl-1,3,4,7-tetrahydropyrano[3,4-c]pyridin-8-one.
| Compound Name | 6-cyclohexyl-1,3,4,7-tetrahydropyrano[3,4-c]pyridin-8-one |
|---|---|
| PubChem CID | 141123603 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 6-cyclohexyl-1,3,4,7-tetrahydropyrano[3,4-c]pyridin-8-one |
| SMILES | O=c1[nH]c(C2CCCCC2)cc2c1COCC2 |
| InChI | InChI=1S/C14H19NO2/c16-14-12-9-17-7-6-11(12)8-13(15-14)10-4-2-1-3-5-10/h8,10H,1-7,9H2,(H,15,16) |
| InChIKey | WVGDCYLOCLAYHW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |