C14H18BrNO2 — CID 141123912
ethyl 2-bromo-2-ethyl-3,4-dihydroquinoline-1-carboxylate (PubChem CID 141123912) has the molecular formula C14H18BrNO2 and a molecular weight of 312.21 g/mol. Its IUPAC name is ethyl 2-bromo-2-ethyl-3,4-dihydroquinoline-1-carboxylate.
| Compound Name | ethyl 2-bromo-2-ethyl-3,4-dihydroquinoline-1-carboxylate |
|---|---|
| PubChem CID | 141123912 |
| Molecular Formula | C14H18BrNO2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | ethyl 2-bromo-2-ethyl-3,4-dihydroquinoline-1-carboxylate |
| SMILES | CCOC(=O)N1c2ccccc2CCC1(Br)CC |
| InChI | InChI=1S/C14H18BrNO2/c1-3-14(15)10-9-11-7-5-6-8-12(11)16(14)13(17)18-4-2/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | RUCLQEINFSENEL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|