About pentafluoro-[4-(5-methyl-1,3-thiazol-2-yl)phenyl]-λ6-sulfane
pentafluoro-[4-(5-methyl-1,3-thiazol-2-yl)phenyl]-λ6-sulfane (PubChem CID 141124129) has the molecular formula C10H8F5NS2
and a molecular weight of 301.31 g/mol. Its IUPAC name is pentafluoro-[4-(5-methyl-1,3-thiazol-2-yl)phenyl]-λ6-sulfane.
Molecular Properties
| Compound Name | pentafluoro-[4-(5-methyl-1,3-thiazol-2-yl)phenyl]-λ6-sulfane |
| PubChem CID | 141124129 |
| Molecular Formula | C10H8F5NS2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | pentafluoro-[4-(5-methyl-1,3-thiazol-2-yl)phenyl]-λ6-sulfane |
| SMILES | Cc1cnc(-c2ccc(S(F)(F)(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C10H8F5NS2/c1-7-6-16-10(17-7)8-2-4-9(5-3-8)18(11,12,13,14)15/h2-6H,1H3 |
| InChIKey | HZZAJBYMFJPLSV-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze pentafluoro-[4-(5-methyl-1,3-thiazol-2-yl)phenyl]-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentafluoro-[4-(5-methyl-1,3-thiazol-2-yl)phenyl]-λ6-sulfane?
The IUPAC name of pentafluoro-[4-(5-methyl-1,3-thiazol-2-yl)phenyl]-λ6-sulfane (CID 141124129) is pentafluoro-[4-(5-methyl-1,3-thiazol-2-yl)phenyl]-λ6-sulfane.
What is the SMILES notation for pentafluoro-[4-(5-methyl-1,3-thiazol-2-yl)phenyl]-λ6-sulfane?
The canonical SMILES for pentafluoro-[4-(5-methyl-1,3-thiazol-2-yl)phenyl]-λ6-sulfane is Cc1cnc(-c2ccc(S(F)(F)(F)(F)F)cc2)s1.
What is the InChIKey of pentafluoro-[4-(5-methyl-1,3-thiazol-2-yl)phenyl]-λ6-sulfane?
The InChIKey is HZZAJBYMFJPLSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F5NS2/c1-7-6-16-10(17-7)8-2-4-9(5-3-8)18(11,12,13,14)15/h2-6H,1H3.
What are the key properties of pentafluoro-[4-(5-methyl-1,3-thiazol-2-yl)phenyl]-λ6-sulfane?
pentafluoro-[4-(5-methyl-1,3-thiazol-2-yl)phenyl]-λ6-sulfane has a molecular weight of 301.31 g/mol, XLogP of 5.78, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentafluoro-[4-(5-methyl-1,3-thiazol-2-yl)phenyl]-λ6-sulfane is sourced from PubChem (CID 141124129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).