C11H13N3O4S — CID 141124264
3-amino-5-(2-ethyl-1,3,2-dioxazinan-4-yl)thieno[3,4-c]pyrrole-4,6-dione (PubChem CID 141124264) has the molecular formula C11H13N3O4S and a molecular weight of 283.31 g/mol. Its IUPAC name is 3-amino-5-(2-ethyl-1,3,2-dioxazinan-4-yl)thieno[3,4-c]pyrrole-4,6-dione.
| Compound Name | 3-amino-5-(2-ethyl-1,3,2-dioxazinan-4-yl)thieno[3,4-c]pyrrole-4,6-dione |
|---|---|
| PubChem CID | 141124264 |
| Molecular Formula | C11H13N3O4S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 3-amino-5-(2-ethyl-1,3,2-dioxazinan-4-yl)thieno[3,4-c]pyrrole-4,6-dione |
| SMILES | CCN1OCCC(N2C(=O)c3csc(N)c3C2=O)O1 |
| InChI | InChI=1S/C11H13N3O4S/c1-2-13-17-4-3-7(18-13)14-10(15)6-5-19-9(12)8(6)11(14)16/h5,7H,2-4,12H2,1H3 |
| InChIKey | PLKAUZSNLAFSHT-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|