About 2-(2-quinolin-2-yl-1,3-thiazol-4-yl)-1,3-oxazole
2-(2-quinolin-2-yl-1,3-thiazol-4-yl)-1,3-oxazole (PubChem CID 141125691) has the molecular formula C15H9N3OS
and a molecular weight of 279.32 g/mol. Its IUPAC name is 2-(2-quinolin-2-yl-1,3-thiazol-4-yl)-1,3-oxazole.
Molecular Properties
| Compound Name | 2-(2-quinolin-2-yl-1,3-thiazol-4-yl)-1,3-oxazole |
| PubChem CID | 141125691 |
| Molecular Formula | C15H9N3OS |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2-(2-quinolin-2-yl-1,3-thiazol-4-yl)-1,3-oxazole |
| SMILES | c1ccc2nc(-c3nc(-c4ncco4)cs3)ccc2c1 |
| InChI | InChI=1S/C15H9N3OS/c1-2-4-11-10(3-1)5-6-12(17-11)15-18-13(9-20-15)14-16-7-8-19-14/h1-9H |
| InChIKey | SVEKFDLNHXPHQK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-quinolin-2-yl-1,3-thiazol-4-yl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-quinolin-2-yl-1,3-thiazol-4-yl)-1,3-oxazole?
The IUPAC name of 2-(2-quinolin-2-yl-1,3-thiazol-4-yl)-1,3-oxazole (CID 141125691) is 2-(2-quinolin-2-yl-1,3-thiazol-4-yl)-1,3-oxazole.
What is the SMILES notation for 2-(2-quinolin-2-yl-1,3-thiazol-4-yl)-1,3-oxazole?
The canonical SMILES for 2-(2-quinolin-2-yl-1,3-thiazol-4-yl)-1,3-oxazole is c1ccc2nc(-c3nc(-c4ncco4)cs3)ccc2c1.
What is the InChIKey of 2-(2-quinolin-2-yl-1,3-thiazol-4-yl)-1,3-oxazole?
The InChIKey is SVEKFDLNHXPHQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9N3OS/c1-2-4-11-10(3-1)5-6-12(17-11)15-18-13(9-20-15)14-16-7-8-19-14/h1-9H.
What are the key properties of 2-(2-quinolin-2-yl-1,3-thiazol-4-yl)-1,3-oxazole?
2-(2-quinolin-2-yl-1,3-thiazol-4-yl)-1,3-oxazole has a molecular weight of 279.32 g/mol, XLogP of 4.01, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-quinolin-2-yl-1,3-thiazol-4-yl)-1,3-oxazole is sourced from PubChem (CID 141125691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).