C8H7F7O — CID 14112670
1,1,1,2,2,3,3-heptafluorooct-7-en-4-one (PubChem CID 14112670) has the molecular formula C8H7F7O and a molecular weight of 252.13 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluorooct-7-en-4-one.
| Compound Name | 1,1,1,2,2,3,3-heptafluorooct-7-en-4-one |
|---|---|
| PubChem CID | 14112670 |
| Molecular Formula | C8H7F7O |
| Molecular Weight | 252.13 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluorooct-7-en-4-one |
| SMILES | C=CCCC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H7F7O/c1-2-3-4-5(16)6(9,10)7(11,12)8(13,14)15/h2H,1,3-4H2 |
| InChIKey | BFWOJUOBSKHJHY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.13 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|