C14H14N2O2 — CID 141128024
[4-(4,5-dihydro-1,2-oxazol-3-yl)phenyl]-(2,5-dihydropyrrol-1-yl)methanone (PubChem CID 141128024) has the molecular formula C14H14N2O2 and a molecular weight of 242.28 g/mol. Its IUPAC name is [4-(4,5-dihydro-1,2-oxazol-3-yl)phenyl]-(2,5-dihydropyrrol-1-yl)methanone.
| Compound Name | [4-(4,5-dihydro-1,2-oxazol-3-yl)phenyl]-(2,5-dihydropyrrol-1-yl)methanone |
|---|---|
| PubChem CID | 141128024 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | [4-(4,5-dihydro-1,2-oxazol-3-yl)phenyl]-(2,5-dihydropyrrol-1-yl)methanone |
| SMILES | O=C(c1ccc(C2=NOCC2)cc1)N1CC=CC1 |
| InChI | InChI=1S/C14H14N2O2/c17-14(16-8-1-2-9-16)12-5-3-11(4-6-12)13-7-10-18-15-13/h1-6H,7-10H2 |
| InChIKey | JFOLWIMKVWBPED-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|