About 1-[1-[(2,4-diethyl-1,3-dioxetan-2-yl)oxy]propoxy]ethyl-dimethoxy-methylsilane
1-[1-[(2,4-diethyl-1,3-dioxetan-2-yl)oxy]propoxy]ethyl-dimethoxy-methylsilane (PubChem CID 141128042) has the molecular formula C14H30O6Si
and a molecular weight of 322.47 g/mol. Its IUPAC name is 1-[1-[(2,4-diethyl-1,3-dioxetan-2-yl)oxy]propoxy]ethyl-dimethoxy-methylsilane.
Molecular Properties
| Compound Name | 1-[1-[(2,4-diethyl-1,3-dioxetan-2-yl)oxy]propoxy]ethyl-dimethoxy-methylsilane |
| PubChem CID | 141128042 |
| Molecular Formula | C14H30O6Si |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 1-[1-[(2,4-diethyl-1,3-dioxetan-2-yl)oxy]propoxy]ethyl-dimethoxy-methylsilane |
| SMILES | CCC(OC(C)[Si](C)(OC)OC)OC1(CC)OC(CC)O1 |
| InChI | InChI=1S/C14H30O6Si/c1-8-12(17-11(4)21(7,15-5)16-6)18-14(10-3)19-13(9-2)20-14/h11-13H,8-10H2,1-7H3 |
| InChIKey | CVUHFLRRYWCFQS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-[(2,4-diethyl-1,3-dioxetan-2-yl)oxy]propoxy]ethyl-dimethoxy-methylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[(2,4-diethyl-1,3-dioxetan-2-yl)oxy]propoxy]ethyl-dimethoxy-methylsilane?
The IUPAC name of 1-[1-[(2,4-diethyl-1,3-dioxetan-2-yl)oxy]propoxy]ethyl-dimethoxy-methylsilane (CID 141128042) is 1-[1-[(2,4-diethyl-1,3-dioxetan-2-yl)oxy]propoxy]ethyl-dimethoxy-methylsilane.
What is the SMILES notation for 1-[1-[(2,4-diethyl-1,3-dioxetan-2-yl)oxy]propoxy]ethyl-dimethoxy-methylsilane?
The canonical SMILES for 1-[1-[(2,4-diethyl-1,3-dioxetan-2-yl)oxy]propoxy]ethyl-dimethoxy-methylsilane is CCC(OC(C)[Si](C)(OC)OC)OC1(CC)OC(CC)O1.
What is the InChIKey of 1-[1-[(2,4-diethyl-1,3-dioxetan-2-yl)oxy]propoxy]ethyl-dimethoxy-methylsilane?
The InChIKey is CVUHFLRRYWCFQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O6Si/c1-8-12(17-11(4)21(7,15-5)16-6)18-14(10-3)19-13(9-2)20-14/h11-13H,8-10H2,1-7H3.
What are the key properties of 1-[1-[(2,4-diethyl-1,3-dioxetan-2-yl)oxy]propoxy]ethyl-dimethoxy-methylsilane?
1-[1-[(2,4-diethyl-1,3-dioxetan-2-yl)oxy]propoxy]ethyl-dimethoxy-methylsilane has a molecular weight of 322.47 g/mol, XLogP of 2.89, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[(2,4-diethyl-1,3-dioxetan-2-yl)oxy]propoxy]ethyl-dimethoxy-methylsilane is sourced from PubChem (CID 141128042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).