C14H18FNO2 — CID 141128990
N-(5-fluoro-2-hydroxy-2,3-dihydro-1H-inden-1-yl)pentanamide (PubChem CID 141128990) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is N-(5-fluoro-2-hydroxy-2,3-dihydro-1H-inden-1-yl)pentanamide.
| Compound Name | N-(5-fluoro-2-hydroxy-2,3-dihydro-1H-inden-1-yl)pentanamide |
|---|---|
| PubChem CID | 141128990 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | N-(5-fluoro-2-hydroxy-2,3-dihydro-1H-inden-1-yl)pentanamide |
| SMILES | CCCCC(=O)NC1c2ccc(F)cc2CC1O |
| InChI | InChI=1S/C14H18FNO2/c1-2-3-4-13(18)16-14-11-6-5-10(15)7-9(11)8-12(14)17/h5-7,12,14,17H,2-4,8H2,1H3,(H,16,18) |
| InChIKey | AFPLYGTWUYXAKI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |