About N-(5-fluoro-2-hydroxy-2,3-dihydro-1H-inden-1-yl)pentanamide
N-(5-fluoro-2-hydroxy-2,3-dihydro-1H-inden-1-yl)pentanamide (PubChem CID 141128990) has the molecular formula C14H18FNO2
and a molecular weight of 251.30 g/mol. Its IUPAC name is N-(5-fluoro-2-hydroxy-2,3-dihydro-1H-inden-1-yl)pentanamide.
Molecular Properties
| Compound Name | N-(5-fluoro-2-hydroxy-2,3-dihydro-1H-inden-1-yl)pentanamide |
| PubChem CID | 141128990 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | N-(5-fluoro-2-hydroxy-2,3-dihydro-1H-inden-1-yl)pentanamide |
| SMILES | CCCCC(=O)NC1c2ccc(F)cc2CC1O |
| InChI | InChI=1S/C14H18FNO2/c1-2-3-4-13(18)16-14-11-6-5-10(15)7-9(11)8-12(14)17/h5-7,12,14,17H,2-4,8H2,1H3,(H,16,18) |
| InChIKey | AFPLYGTWUYXAKI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(5-fluoro-2-hydroxy-2,3-dihydro-1H-inden-1-yl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-fluoro-2-hydroxy-2,3-dihydro-1H-inden-1-yl)pentanamide?
The IUPAC name of N-(5-fluoro-2-hydroxy-2,3-dihydro-1H-inden-1-yl)pentanamide (CID 141128990) is N-(5-fluoro-2-hydroxy-2,3-dihydro-1H-inden-1-yl)pentanamide.
What is the SMILES notation for N-(5-fluoro-2-hydroxy-2,3-dihydro-1H-inden-1-yl)pentanamide?
The canonical SMILES for N-(5-fluoro-2-hydroxy-2,3-dihydro-1H-inden-1-yl)pentanamide is CCCCC(=O)NC1c2ccc(F)cc2CC1O.
What is the InChIKey of N-(5-fluoro-2-hydroxy-2,3-dihydro-1H-inden-1-yl)pentanamide?
The InChIKey is AFPLYGTWUYXAKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18FNO2/c1-2-3-4-13(18)16-14-11-6-5-10(15)7-9(11)8-12(14)17/h5-7,12,14,17H,2-4,8H2,1H3,(H,16,18).
What are the key properties of N-(5-fluoro-2-hydroxy-2,3-dihydro-1H-inden-1-yl)pentanamide?
N-(5-fluoro-2-hydroxy-2,3-dihydro-1H-inden-1-yl)pentanamide has a molecular weight of 251.30 g/mol, XLogP of 2.09, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-fluoro-2-hydroxy-2,3-dihydro-1H-inden-1-yl)pentanamide is sourced from PubChem (CID 141128990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).