About pentan-3-yl cyclohepta[f]indole-5-carboxylate
pentan-3-yl cyclohepta[f]indole-5-carboxylate (PubChem CID 141129009) has the molecular formula C19H19NO2
and a molecular weight of 293.37 g/mol. Its IUPAC name is pentan-3-yl cyclohepta[f]indole-5-carboxylate.
Molecular Properties
| Compound Name | pentan-3-yl cyclohepta[f]indole-5-carboxylate |
| PubChem CID | 141129009 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | pentan-3-yl cyclohepta[f]indole-5-carboxylate |
| SMILES | CCC(CC)OC(=O)c1ccccc2cc3nccc3cc12 |
| InChI | InChI=1S/C19H19NO2/c1-3-15(4-2)22-19(21)16-8-6-5-7-13-12-18-14(9-10-20-18)11-17(13)16/h5-12,15H,3-4H2,1-2H3 |
| InChIKey | ZCPXTSKPUMICDN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pentan-3-yl cyclohepta[f]indole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-3-yl cyclohepta[f]indole-5-carboxylate?
The IUPAC name of pentan-3-yl cyclohepta[f]indole-5-carboxylate (CID 141129009) is pentan-3-yl cyclohepta[f]indole-5-carboxylate.
What is the SMILES notation for pentan-3-yl cyclohepta[f]indole-5-carboxylate?
The canonical SMILES for pentan-3-yl cyclohepta[f]indole-5-carboxylate is CCC(CC)OC(=O)c1ccccc2cc3nccc3cc12.
What is the InChIKey of pentan-3-yl cyclohepta[f]indole-5-carboxylate?
The InChIKey is ZCPXTSKPUMICDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO2/c1-3-15(4-2)22-19(21)16-8-6-5-7-13-12-18-14(9-10-20-18)11-17(13)16/h5-12,15H,3-4H2,1-2H3.
What are the key properties of pentan-3-yl cyclohepta[f]indole-5-carboxylate?
pentan-3-yl cyclohepta[f]indole-5-carboxylate has a molecular weight of 293.37 g/mol, XLogP of 4.73, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-3-yl cyclohepta[f]indole-5-carboxylate is sourced from PubChem (CID 141129009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).