C18H18ClF3N4O — CID 141129528
2-[4-[(6-chloro-2-methylpyrimidin-4-yl)amino]cyclohexyl]-3,4,5-trifluorobenzamide (PubChem CID 141129528) has the molecular formula C18H18ClF3N4O and a molecular weight of 398.82 g/mol. Its IUPAC name is 2-[4-[(6-chloro-2-methylpyrimidin-4-yl)amino]cyclohexyl]-3,4,5-trifluorobenzamide.
| Compound Name | 2-[4-[(6-chloro-2-methylpyrimidin-4-yl)amino]cyclohexyl]-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 141129528 |
| Molecular Formula | C18H18ClF3N4O |
| Molecular Weight | 398.82 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 2-[4-[(6-chloro-2-methylpyrimidin-4-yl)amino]cyclohexyl]-3,4,5-trifluorobenzamide |
| SMILES | Cc1nc(Cl)cc(NC2CCC(c3c(C(N)=O)cc(F)c(F)c3F)CC2)n1 |
| InChI | InChI=1S/C18H18ClF3N4O/c1-8-24-13(19)7-14(25-8)26-10-4-2-9(3-5-10)15-11(18(23)27)6-12(20)16(21)17(15)22/h6-7,9-10H,2-5H2,1H3,(H2,23,27)(H,24,25,26) |
| InChIKey | KMRDTBREOUPNPJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.82 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|