C18H21FN2O2 — CID 141129542
N-[(2-fluoro-5-methyl-3-pyridinyl)methyl]-2-hydroxy-2-phenylpentanamide (PubChem CID 141129542) has the molecular formula C18H21FN2O2 and a molecular weight of 316.38 g/mol. Its IUPAC name is N-[(2-fluoro-5-methyl-3-pyridinyl)methyl]-2-hydroxy-2-phenylpentanamide.
| Compound Name | N-[(2-fluoro-5-methyl-3-pyridinyl)methyl]-2-hydroxy-2-phenylpentanamide |
|---|---|
| PubChem CID | 141129542 |
| Molecular Formula | C18H21FN2O2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | N-[(2-fluoro-5-methyl-3-pyridinyl)methyl]-2-hydroxy-2-phenylpentanamide |
| SMILES | CCCC(O)(C(=O)NCc1cc(C)cnc1F)c1ccccc1 |
| InChI | InChI=1S/C18H21FN2O2/c1-3-9-18(23,15-7-5-4-6-8-15)17(22)21-12-14-10-13(2)11-20-16(14)19/h4-8,10-11,23H,3,9,12H2,1-2H3,(H,21,22) |
| InChIKey | LUFYVHISJWFMFX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|