C11H12Cl2F12OSi — CID 141130012
dichloro-[3-(1,1,2,2,3,3,4,4,5,7,7,7-dodecafluoroheptoxy)propyl]-methylsilane (PubChem CID 141130012) has the molecular formula C11H12Cl2F12OSi and a molecular weight of 487.18 g/mol. Its IUPAC name is dichloro-[3-(1,1,2,2,3,3,4,4,5,7,7,7-dodecafluoroheptoxy)propyl]-methylsilane.
| Compound Name | dichloro-[3-(1,1,2,2,3,3,4,4,5,7,7,7-dodecafluoroheptoxy)propyl]-methylsilane |
|---|---|
| PubChem CID | 141130012 |
| Molecular Formula | C11H12Cl2F12OSi |
| Molecular Weight | 487.18 g/mol |
| Exact Mass | 485.98 |
| IUPAC Name | dichloro-[3-(1,1,2,2,3,3,4,4,5,7,7,7-dodecafluoroheptoxy)propyl]-methylsilane |
| SMILES | C[Si](Cl)(Cl)CCCOC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)CC(F)(F)F |
| InChI | InChI=1S/C11H12Cl2F12OSi/c1-27(12,13)4-2-3-26-11(24,25)10(22,23)9(20,21)8(18,19)6(14)5-7(15,16)17/h6H,2-5H2,1H3 |
| InChIKey | UBZOQXPLZOVLPA-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.18 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|