C21H19ClO3 — CID 141130050
ethyl 4-(4-chlorophenyl)-6-oxo-2-phenylcyclohexene-1-carboxylate (PubChem CID 141130050) has the molecular formula C21H19ClO3 and a molecular weight of 354.83 g/mol. Its IUPAC name is ethyl 4-(4-chlorophenyl)-6-oxo-2-phenylcyclohexene-1-carboxylate.
| Compound Name | ethyl 4-(4-chlorophenyl)-6-oxo-2-phenylcyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 141130050 |
| Molecular Formula | C21H19ClO3 |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | ethyl 4-(4-chlorophenyl)-6-oxo-2-phenylcyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)CC(c2ccc(Cl)cc2)CC1=O |
| InChI | InChI=1S/C21H19ClO3/c1-2-25-21(24)20-18(15-6-4-3-5-7-15)12-16(13-19(20)23)14-8-10-17(22)11-9-14/h3-11,16H,2,12-13H2,1H3 |
| InChIKey | MOSIYQGMWMPTCA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|