About 1,12-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9-tetraene
1,12-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9-tetraene (PubChem CID 141130716) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 1,12-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9-tetraene.
Analyze 1,12-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,12-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9-tetraene?
The IUPAC name of 1,12-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9-tetraene (CID 141130716) is 1,12-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9-tetraene.
What is the SMILES notation for 1,12-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9-tetraene?
The canonical SMILES for 1,12-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9-tetraene is C1=CC2=C(C=CC3=CCNN32)C1.
What is the InChIKey of 1,12-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9-tetraene?
The InChIKey is LKSKAXNMEVMRBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2/c1-2-8-4-5-9-6-7-11-12(9)10(8)3-1/h1,3-6,11H,2,7H2.
What are the key properties of 1,12-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9-tetraene?
1,12-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9-tetraene has a molecular weight of 158.20 g/mol, XLogP of 1.47, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,12-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9-tetraene is sourced from PubChem (CID 141130716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).