C6H5N3S2 — CID 141130779
5-thiophen-2-ylsulfanyl-1H-1,2,4-triazole (PubChem CID 141130779) has the molecular formula C6H5N3S2 and a molecular weight of 183.26 g/mol. Its IUPAC name is 5-thiophen-2-ylsulfanyl-1H-1,2,4-triazole.
| Compound Name | 5-thiophen-2-ylsulfanyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 141130779 |
| Molecular Formula | C6H5N3S2 |
| Molecular Weight | 183.26 g/mol |
| Exact Mass | 182.99 |
| IUPAC Name | 5-thiophen-2-ylsulfanyl-1H-1,2,4-triazole |
| SMILES | c1csc(Sc2ncn[nH]2)c1 |
| InChI | InChI=1S/C6H5N3S2/c1-2-5(10-3-1)11-6-7-4-8-9-6/h1-4H,(H,7,8,9) |
| InChIKey | RMJRIKLSLSMZAV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |