About lithium;di(propan-2-yl)azanide;1-methylpiperidine
lithium;di(propan-2-yl)azanide;1-methylpiperidine (PubChem CID 141131230) has the molecular formula C12H27LiN2
and a molecular weight of 206.30 g/mol. Its IUPAC name is lithium;di(propan-2-yl)azanide;1-methylpiperidine.
Molecular Properties
| Compound Name | lithium;di(propan-2-yl)azanide;1-methylpiperidine |
| PubChem CID | 141131230 |
| Molecular Formula | C12H27LiN2 |
| Molecular Weight | 206.30 g/mol |
| Exact Mass | 206.23 |
| IUPAC Name | lithium;di(propan-2-yl)azanide;1-methylpiperidine |
| SMILES | CC(C)[N-]C(C)C.CN1CCCCC1.[Li+] |
| InChI | InChI=1S/C6H13N.C6H14N.Li/c1-7-5-3-2-4-6-7;1-5(2)7-6(3)4;/h2-6H2,1H3;5-6H,1-4H3;/q;-1;+1 |
| InChIKey | CVKLMZXXDVIWAX-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.30 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze lithium;di(propan-2-yl)azanide;1-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;di(propan-2-yl)azanide;1-methylpiperidine?
The IUPAC name of lithium;di(propan-2-yl)azanide;1-methylpiperidine (CID 141131230) is lithium;di(propan-2-yl)azanide;1-methylpiperidine.
What is the SMILES notation for lithium;di(propan-2-yl)azanide;1-methylpiperidine?
The canonical SMILES for lithium;di(propan-2-yl)azanide;1-methylpiperidine is CC(C)[N-]C(C)C.CN1CCCCC1.[Li+].
What is the InChIKey of lithium;di(propan-2-yl)azanide;1-methylpiperidine?
The InChIKey is CVKLMZXXDVIWAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C6H14N.Li/c1-7-5-3-2-4-6-7;1-5(2)7-6(3)4;/h2-6H2,1H3;5-6H,1-4H3;/q;-1;+1.
What are the key properties of lithium;di(propan-2-yl)azanide;1-methylpiperidine?
lithium;di(propan-2-yl)azanide;1-methylpiperidine has a molecular weight of 206.30 g/mol, XLogP of 0.28, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;di(propan-2-yl)azanide;1-methylpiperidine is sourced from PubChem (CID 141131230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).