C21H39NO — CID 141131937
N-[bis(2,2,6,6-tetramethylcyclohexyl)methylidene]hydroxylamine (PubChem CID 141131937) has the molecular formula C21H39NO and a molecular weight of 321.55 g/mol. Its IUPAC name is N-[bis(2,2,6,6-tetramethylcyclohexyl)methylidene]hydroxylamine.
| Compound Name | N-[bis(2,2,6,6-tetramethylcyclohexyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 141131937 |
| Molecular Formula | C21H39NO |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 321.30 |
| IUPAC Name | N-[bis(2,2,6,6-tetramethylcyclohexyl)methylidene]hydroxylamine |
| SMILES | CC1(C)CCCC(C)(C)C1C(=NO)C1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C21H39NO/c1-18(2)11-9-12-19(3,4)16(18)15(22-23)17-20(5,6)13-10-14-21(17,7)8/h16-17,23H,9-14H2,1-8H3 |
| InChIKey | MGZMWRZLJVTDBC-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|