C15H27ClN2 — CID 141131957
4-chloro-1,2-dihexylimidazole (PubChem CID 141131957) has the molecular formula C15H27ClN2 and a molecular weight of 270.85 g/mol. Its IUPAC name is 4-chloro-1,2-dihexylimidazole.
| Compound Name | 4-chloro-1,2-dihexylimidazole |
|---|---|
| PubChem CID | 141131957 |
| Molecular Formula | C15H27ClN2 |
| Molecular Weight | 270.85 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 4-chloro-1,2-dihexylimidazole |
| SMILES | CCCCCCc1nc(Cl)cn1CCCCCC |
| InChI | InChI=1S/C15H27ClN2/c1-3-5-7-9-11-15-17-14(16)13-18(15)12-10-8-6-4-2/h13H,3-12H2,1-2H3 |
| InChIKey | YJWFHBOVFVYSQQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.85 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|