C27H22O4S — CID 141132393
(5,7-diphenyl-2,3-dihydro-1-benzofuran-2-yl)methyl benzenesulfonate (PubChem CID 141132393) has the molecular formula C27H22O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is (5,7-diphenyl-2,3-dihydro-1-benzofuran-2-yl)methyl benzenesulfonate.
| Compound Name | (5,7-diphenyl-2,3-dihydro-1-benzofuran-2-yl)methyl benzenesulfonate |
|---|---|
| PubChem CID | 141132393 |
| Molecular Formula | C27H22O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | (5,7-diphenyl-2,3-dihydro-1-benzofuran-2-yl)methyl benzenesulfonate |
| SMILES | O=S(=O)(OCC1Cc2cc(-c3ccccc3)cc(-c3ccccc3)c2O1)c1ccccc1 |
| InChI | InChI=1S/C27H22O4S/c28-32(29,25-14-8-3-9-15-25)30-19-24-17-23-16-22(20-10-4-1-5-11-20)18-26(27(23)31-24)21-12-6-2-7-13-21/h1-16,18,24H,17,19H2 |
| InChIKey | GARZRXHVFGZUNS-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|