About (5,7-diphenyl-2,3-dihydro-1-benzofuran-2-yl)methyl benzenesulfonate
(5,7-diphenyl-2,3-dihydro-1-benzofuran-2-yl)methyl benzenesulfonate (PubChem CID 141132393) has the molecular formula C27H22O4S
and a molecular weight of 442.54 g/mol. Its IUPAC name is (5,7-diphenyl-2,3-dihydro-1-benzofuran-2-yl)methyl benzenesulfonate.
Molecular Properties
| Compound Name | (5,7-diphenyl-2,3-dihydro-1-benzofuran-2-yl)methyl benzenesulfonate |
| PubChem CID | 141132393 |
| Molecular Formula | C27H22O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | (5,7-diphenyl-2,3-dihydro-1-benzofuran-2-yl)methyl benzenesulfonate |
| SMILES | O=S(=O)(OCC1Cc2cc(-c3ccccc3)cc(-c3ccccc3)c2O1)c1ccccc1 |
| InChI | InChI=1S/C27H22O4S/c28-32(29,25-14-8-3-9-15-25)30-19-24-17-23-16-22(20-10-4-1-5-11-20)18-26(27(23)31-24)21-12-6-2-7-13-21/h1-16,18,24H,17,19H2 |
| InChIKey | GARZRXHVFGZUNS-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (5,7-diphenyl-2,3-dihydro-1-benzofuran-2-yl)methyl benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,7-diphenyl-2,3-dihydro-1-benzofuran-2-yl)methyl benzenesulfonate?
The IUPAC name of (5,7-diphenyl-2,3-dihydro-1-benzofuran-2-yl)methyl benzenesulfonate (CID 141132393) is (5,7-diphenyl-2,3-dihydro-1-benzofuran-2-yl)methyl benzenesulfonate.
What is the SMILES notation for (5,7-diphenyl-2,3-dihydro-1-benzofuran-2-yl)methyl benzenesulfonate?
The canonical SMILES for (5,7-diphenyl-2,3-dihydro-1-benzofuran-2-yl)methyl benzenesulfonate is O=S(=O)(OCC1Cc2cc(-c3ccccc3)cc(-c3ccccc3)c2O1)c1ccccc1.
What is the InChIKey of (5,7-diphenyl-2,3-dihydro-1-benzofuran-2-yl)methyl benzenesulfonate?
The InChIKey is GARZRXHVFGZUNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H22O4S/c28-32(29,25-14-8-3-9-15-25)30-19-24-17-23-16-22(20-10-4-1-5-11-20)18-26(27(23)31-24)21-12-6-2-7-13-21/h1-16,18,24H,17,19H2.
What are the key properties of (5,7-diphenyl-2,3-dihydro-1-benzofuran-2-yl)methyl benzenesulfonate?
(5,7-diphenyl-2,3-dihydro-1-benzofuran-2-yl)methyl benzenesulfonate has a molecular weight of 442.54 g/mol, XLogP of 5.73, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5,7-diphenyl-2,3-dihydro-1-benzofuran-2-yl)methyl benzenesulfonate is sourced from PubChem (CID 141132393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).