About 1,3-dichloro-5-[3-(3,5-dichlorophenoxy)pentan-3-yloxy]benzene
1,3-dichloro-5-[3-(3,5-dichlorophenoxy)pentan-3-yloxy]benzene (PubChem CID 141132428) has the molecular formula C17H16Cl4O2
and a molecular weight of 394.13 g/mol. Its IUPAC name is 1,3-dichloro-5-[3-(3,5-dichlorophenoxy)pentan-3-yloxy]benzene.
Molecular Properties
| Compound Name | 1,3-dichloro-5-[3-(3,5-dichlorophenoxy)pentan-3-yloxy]benzene |
| PubChem CID | 141132428 |
| Molecular Formula | C17H16Cl4O2 |
| Molecular Weight | 394.13 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | 1,3-dichloro-5-[3-(3,5-dichlorophenoxy)pentan-3-yloxy]benzene |
| SMILES | CCC(CC)(Oc1cc(Cl)cc(Cl)c1)Oc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H16Cl4O2/c1-3-17(4-2,22-15-7-11(18)5-12(19)8-15)23-16-9-13(20)6-14(21)10-16/h5-10H,3-4H2,1-2H3 |
| InChIKey | JJKUSJRNUNNGNP-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.13 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dichloro-5-[3-(3,5-dichlorophenoxy)pentan-3-yloxy]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichloro-5-[3-(3,5-dichlorophenoxy)pentan-3-yloxy]benzene?
The IUPAC name of 1,3-dichloro-5-[3-(3,5-dichlorophenoxy)pentan-3-yloxy]benzene (CID 141132428) is 1,3-dichloro-5-[3-(3,5-dichlorophenoxy)pentan-3-yloxy]benzene.
What is the SMILES notation for 1,3-dichloro-5-[3-(3,5-dichlorophenoxy)pentan-3-yloxy]benzene?
The canonical SMILES for 1,3-dichloro-5-[3-(3,5-dichlorophenoxy)pentan-3-yloxy]benzene is CCC(CC)(Oc1cc(Cl)cc(Cl)c1)Oc1cc(Cl)cc(Cl)c1.
What is the InChIKey of 1,3-dichloro-5-[3-(3,5-dichlorophenoxy)pentan-3-yloxy]benzene?
The InChIKey is JJKUSJRNUNNGNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16Cl4O2/c1-3-17(4-2,22-15-7-11(18)5-12(19)8-15)23-16-9-13(20)6-14(21)10-16/h5-10H,3-4H2,1-2H3.
What are the key properties of 1,3-dichloro-5-[3-(3,5-dichlorophenoxy)pentan-3-yloxy]benzene?
1,3-dichloro-5-[3-(3,5-dichlorophenoxy)pentan-3-yloxy]benzene has a molecular weight of 394.13 g/mol, XLogP of 7.27, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichloro-5-[3-(3,5-dichlorophenoxy)pentan-3-yloxy]benzene is sourced from PubChem (CID 141132428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).