About methyl 4-[2-[4-[(2,4-dihydroxy-1,3-thiazolidin-5-yl)methyl]phenoxy]ethoxy]benzoate
methyl 4-[2-[4-[(2,4-dihydroxy-1,3-thiazolidin-5-yl)methyl]phenoxy]ethoxy]benzoate (PubChem CID 141132473) has the molecular formula C20H23NO6S
and a molecular weight of 405.47 g/mol. Its IUPAC name is methyl 4-[2-[4-[(2,4-dihydroxy-1,3-thiazolidin-5-yl)methyl]phenoxy]ethoxy]benzoate.
Molecular Properties
| Compound Name | methyl 4-[2-[4-[(2,4-dihydroxy-1,3-thiazolidin-5-yl)methyl]phenoxy]ethoxy]benzoate |
| PubChem CID | 141132473 |
| Molecular Formula | C20H23NO6S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | methyl 4-[2-[4-[(2,4-dihydroxy-1,3-thiazolidin-5-yl)methyl]phenoxy]ethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCCOc2ccc(CC3SC(O)NC3O)cc2)cc1 |
| InChI | InChI=1S/C20H23NO6S/c1-25-19(23)14-4-8-16(9-5-14)27-11-10-26-15-6-2-13(3-7-15)12-17-18(22)21-20(24)28-17/h2-9,17-18,20-22,24H,10-12H2,1H3 |
| InChIKey | KGIOREPNYMSXCU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[2-[4-[(2,4-dihydroxy-1,3-thiazolidin-5-yl)methyl]phenoxy]ethoxy]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[2-[4-[(2,4-dihydroxy-1,3-thiazolidin-5-yl)methyl]phenoxy]ethoxy]benzoate?
The IUPAC name of methyl 4-[2-[4-[(2,4-dihydroxy-1,3-thiazolidin-5-yl)methyl]phenoxy]ethoxy]benzoate (CID 141132473) is methyl 4-[2-[4-[(2,4-dihydroxy-1,3-thiazolidin-5-yl)methyl]phenoxy]ethoxy]benzoate.
What is the SMILES notation for methyl 4-[2-[4-[(2,4-dihydroxy-1,3-thiazolidin-5-yl)methyl]phenoxy]ethoxy]benzoate?
The canonical SMILES for methyl 4-[2-[4-[(2,4-dihydroxy-1,3-thiazolidin-5-yl)methyl]phenoxy]ethoxy]benzoate is COC(=O)c1ccc(OCCOc2ccc(CC3SC(O)NC3O)cc2)cc1.
What is the InChIKey of methyl 4-[2-[4-[(2,4-dihydroxy-1,3-thiazolidin-5-yl)methyl]phenoxy]ethoxy]benzoate?
The InChIKey is KGIOREPNYMSXCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO6S/c1-25-19(23)14-4-8-16(9-5-14)27-11-10-26-15-6-2-13(3-7-15)12-17-18(22)21-20(24)28-17/h2-9,17-18,20-22,24H,10-12H2,1H3.
What are the key properties of methyl 4-[2-[4-[(2,4-dihydroxy-1,3-thiazolidin-5-yl)methyl]phenoxy]ethoxy]benzoate?
methyl 4-[2-[4-[(2,4-dihydroxy-1,3-thiazolidin-5-yl)methyl]phenoxy]ethoxy]benzoate has a molecular weight of 405.47 g/mol, XLogP of 1.77, 8 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2-[4-[(2,4-dihydroxy-1,3-thiazolidin-5-yl)methyl]phenoxy]ethoxy]benzoate is sourced from PubChem (CID 141132473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).