About [5-methyl-4-(2-methyl-1,3-dioxol-2-yl)-1,2-oxazol-3-yl]methanol
[5-methyl-4-(2-methyl-1,3-dioxol-2-yl)-1,2-oxazol-3-yl]methanol (PubChem CID 141132476) has the molecular formula C9H11NO4
and a molecular weight of 197.19 g/mol. Its IUPAC name is [5-methyl-4-(2-methyl-1,3-dioxol-2-yl)-1,2-oxazol-3-yl]methanol.
Molecular Properties
| Compound Name | [5-methyl-4-(2-methyl-1,3-dioxol-2-yl)-1,2-oxazol-3-yl]methanol |
| PubChem CID | 141132476 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | [5-methyl-4-(2-methyl-1,3-dioxol-2-yl)-1,2-oxazol-3-yl]methanol |
| SMILES | Cc1onc(CO)c1C1(C)OC=CO1 |
| InChI | InChI=1S/C9H11NO4/c1-6-8(7(5-11)10-14-6)9(2)12-3-4-13-9/h3-4,11H,5H2,1-2H3 |
| InChIKey | KPFXCXRJISCBHA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 64.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-methyl-4-(2-methyl-1,3-dioxol-2-yl)-1,2-oxazol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-methyl-4-(2-methyl-1,3-dioxol-2-yl)-1,2-oxazol-3-yl]methanol?
The IUPAC name of [5-methyl-4-(2-methyl-1,3-dioxol-2-yl)-1,2-oxazol-3-yl]methanol (CID 141132476) is [5-methyl-4-(2-methyl-1,3-dioxol-2-yl)-1,2-oxazol-3-yl]methanol.
What is the SMILES notation for [5-methyl-4-(2-methyl-1,3-dioxol-2-yl)-1,2-oxazol-3-yl]methanol?
The canonical SMILES for [5-methyl-4-(2-methyl-1,3-dioxol-2-yl)-1,2-oxazol-3-yl]methanol is Cc1onc(CO)c1C1(C)OC=CO1.
What is the InChIKey of [5-methyl-4-(2-methyl-1,3-dioxol-2-yl)-1,2-oxazol-3-yl]methanol?
The InChIKey is KPFXCXRJISCBHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO4/c1-6-8(7(5-11)10-14-6)9(2)12-3-4-13-9/h3-4,11H,5H2,1-2H3.
What are the key properties of [5-methyl-4-(2-methyl-1,3-dioxol-2-yl)-1,2-oxazol-3-yl]methanol?
[5-methyl-4-(2-methyl-1,3-dioxol-2-yl)-1,2-oxazol-3-yl]methanol has a molecular weight of 197.19 g/mol, XLogP of 1.17, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-methyl-4-(2-methyl-1,3-dioxol-2-yl)-1,2-oxazol-3-yl]methanol is sourced from PubChem (CID 141132476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).