C22H29N5O3 — CID 141132596
4-[[[6-(4-butanoylanilino)pyrimidin-4-yl]-methylamino]methyl]piperidine-1-carboxylic acid (PubChem CID 141132596) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is 4-[[[6-(4-butanoylanilino)pyrimidin-4-yl]-methylamino]methyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[[[6-(4-butanoylanilino)pyrimidin-4-yl]-methylamino]methyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 141132596 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 4-[[[6-(4-butanoylanilino)pyrimidin-4-yl]-methylamino]methyl]piperidine-1-carboxylic acid |
| SMILES | CCCC(=O)c1ccc(Nc2cc(N(C)CC3CCN(C(=O)O)CC3)ncn2)cc1 |
| InChI | InChI=1S/C22H29N5O3/c1-3-4-19(28)17-5-7-18(8-6-17)25-20-13-21(24-15-23-20)26(2)14-16-9-11-27(12-10-16)22(29)30/h5-8,13,15-16H,3-4,9-12,14H2,1-2H3,(H,29,30)(H,23,24,25) |
| InChIKey | QGRYRYRKBQSJPL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |