About 1-benzyl-3,3-dimethyl-2H-indole
1-benzyl-3,3-dimethyl-2H-indole (PubChem CID 14113269) has the molecular formula C17H19N
and a molecular weight of 237.35 g/mol. Its IUPAC name is 1-benzyl-3,3-dimethyl-2H-indole.
Molecular Properties
| Compound Name | 1-benzyl-3,3-dimethyl-2H-indole |
| PubChem CID | 14113269 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 1-benzyl-3,3-dimethyl-2H-indole |
| SMILES | CC1(C)CN(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C17H19N/c1-17(2)13-18(12-14-8-4-3-5-9-14)16-11-7-6-10-15(16)17/h3-11H,12-13H2,1-2H3 |
| InChIKey | IUVLOTZERXIAKW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzyl-3,3-dimethyl-2H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3,3-dimethyl-2H-indole?
The IUPAC name of 1-benzyl-3,3-dimethyl-2H-indole (CID 14113269) is 1-benzyl-3,3-dimethyl-2H-indole.
What is the SMILES notation for 1-benzyl-3,3-dimethyl-2H-indole?
The canonical SMILES for 1-benzyl-3,3-dimethyl-2H-indole is CC1(C)CN(Cc2ccccc2)c2ccccc21.
What is the InChIKey of 1-benzyl-3,3-dimethyl-2H-indole?
The InChIKey is IUVLOTZERXIAKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N/c1-17(2)13-18(12-14-8-4-3-5-9-14)16-11-7-6-10-15(16)17/h3-11H,12-13H2,1-2H3.
What are the key properties of 1-benzyl-3,3-dimethyl-2H-indole?
1-benzyl-3,3-dimethyl-2H-indole has a molecular weight of 237.35 g/mol, XLogP of 3.98, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3,3-dimethyl-2H-indole is sourced from PubChem (CID 14113269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).