C13H9FN2O — CID 141134187
4-(2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 141134187) has the molecular formula C13H9FN2O and a molecular weight of 228.23 g/mol. Its IUPAC name is 4-(2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 4-(2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 141134187 |
| Molecular Formula | C13H9FN2O |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 4-(2-fluorophenoxy)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Fc1ccccc1Oc1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C13H9FN2O/c14-10-3-1-2-4-12(10)17-11-6-8-16-13-9(11)5-7-15-13/h1-8H,(H,15,16) |
| InChIKey | OTFKGRIYLVVASI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |