About 6-methyl-4-phenyl-1,2-dihydropyridine
6-methyl-4-phenyl-1,2-dihydropyridine (PubChem CID 141134775) has the molecular formula C12H13N
and a molecular weight of 171.24 g/mol. Its IUPAC name is 6-methyl-4-phenyl-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 6-methyl-4-phenyl-1,2-dihydropyridine |
| PubChem CID | 141134775 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 6-methyl-4-phenyl-1,2-dihydropyridine |
| SMILES | CC1=CC(c2ccccc2)=CCN1 |
| InChI | InChI=1S/C12H13N/c1-10-9-12(7-8-13-10)11-5-3-2-4-6-11/h2-7,9,13H,8H2,1H3 |
| InChIKey | DAJAPSYRMNLGPI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-methyl-4-phenyl-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4-phenyl-1,2-dihydropyridine?
The IUPAC name of 6-methyl-4-phenyl-1,2-dihydropyridine (CID 141134775) is 6-methyl-4-phenyl-1,2-dihydropyridine.
What is the SMILES notation for 6-methyl-4-phenyl-1,2-dihydropyridine?
The canonical SMILES for 6-methyl-4-phenyl-1,2-dihydropyridine is CC1=CC(c2ccccc2)=CCN1.
What is the InChIKey of 6-methyl-4-phenyl-1,2-dihydropyridine?
The InChIKey is DAJAPSYRMNLGPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N/c1-10-9-12(7-8-13-10)11-5-3-2-4-6-11/h2-7,9,13H,8H2,1H3.
What are the key properties of 6-methyl-4-phenyl-1,2-dihydropyridine?
6-methyl-4-phenyl-1,2-dihydropyridine has a molecular weight of 171.24 g/mol, XLogP of 2.58, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4-phenyl-1,2-dihydropyridine is sourced from PubChem (CID 141134775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).