About 2-ethylthieno[3,2-b]pyrrole-3,4-diamine
2-ethylthieno[3,2-b]pyrrole-3,4-diamine (PubChem CID 141134825) has the molecular formula C8H11N3S
and a molecular weight of 181.26 g/mol. Its IUPAC name is 2-ethylthieno[3,2-b]pyrrole-3,4-diamine.
Molecular Properties
| Compound Name | 2-ethylthieno[3,2-b]pyrrole-3,4-diamine |
| PubChem CID | 141134825 |
| Molecular Formula | C8H11N3S |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2-ethylthieno[3,2-b]pyrrole-3,4-diamine |
| SMILES | CCc1sc2ccn(N)c2c1N |
| InChI | InChI=1S/C8H11N3S/c1-2-5-7(9)8-6(12-5)3-4-11(8)10/h3-4H,2,9-10H2,1H3 |
| InChIKey | WMSYKQLAHUACLT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 56.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethylthieno[3,2-b]pyrrole-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylthieno[3,2-b]pyrrole-3,4-diamine?
The IUPAC name of 2-ethylthieno[3,2-b]pyrrole-3,4-diamine (CID 141134825) is 2-ethylthieno[3,2-b]pyrrole-3,4-diamine.
What is the SMILES notation for 2-ethylthieno[3,2-b]pyrrole-3,4-diamine?
The canonical SMILES for 2-ethylthieno[3,2-b]pyrrole-3,4-diamine is CCc1sc2ccn(N)c2c1N.
What is the InChIKey of 2-ethylthieno[3,2-b]pyrrole-3,4-diamine?
The InChIKey is WMSYKQLAHUACLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3S/c1-2-5-7(9)8-6(12-5)3-4-11(8)10/h3-4H,2,9-10H2,1H3.
What are the key properties of 2-ethylthieno[3,2-b]pyrrole-3,4-diamine?
2-ethylthieno[3,2-b]pyrrole-3,4-diamine has a molecular weight of 181.26 g/mol, XLogP of 1.56, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylthieno[3,2-b]pyrrole-3,4-diamine is sourced from PubChem (CID 141134825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).