About 2-[(2-aminocyclohexa-2,4-dien-1-yl)amino]ethanol
2-[(2-aminocyclohexa-2,4-dien-1-yl)amino]ethanol (PubChem CID 141134918) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-[(2-aminocyclohexa-2,4-dien-1-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[(2-aminocyclohexa-2,4-dien-1-yl)amino]ethanol |
| PubChem CID | 141134918 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 2-[(2-aminocyclohexa-2,4-dien-1-yl)amino]ethanol |
| SMILES | NC1=CC=CCC1NCCO |
| InChI | InChI=1S/C8H14N2O/c9-7-3-1-2-4-8(7)10-5-6-11/h1-3,8,10-11H,4-6,9H2 |
| InChIKey | OAVIOZOFTHPMKG-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2-aminocyclohexa-2,4-dien-1-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-aminocyclohexa-2,4-dien-1-yl)amino]ethanol?
The IUPAC name of 2-[(2-aminocyclohexa-2,4-dien-1-yl)amino]ethanol (CID 141134918) is 2-[(2-aminocyclohexa-2,4-dien-1-yl)amino]ethanol.
What is the SMILES notation for 2-[(2-aminocyclohexa-2,4-dien-1-yl)amino]ethanol?
The canonical SMILES for 2-[(2-aminocyclohexa-2,4-dien-1-yl)amino]ethanol is NC1=CC=CCC1NCCO.
What is the InChIKey of 2-[(2-aminocyclohexa-2,4-dien-1-yl)amino]ethanol?
The InChIKey is OAVIOZOFTHPMKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c9-7-3-1-2-4-8(7)10-5-6-11/h1-3,8,10-11H,4-6,9H2.
What are the key properties of 2-[(2-aminocyclohexa-2,4-dien-1-yl)amino]ethanol?
2-[(2-aminocyclohexa-2,4-dien-1-yl)amino]ethanol has a molecular weight of 154.21 g/mol, XLogP of -0.26, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-aminocyclohexa-2,4-dien-1-yl)amino]ethanol is sourced from PubChem (CID 141134918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).