About 1-propan-2-yloxyindazole
1-propan-2-yloxyindazole (PubChem CID 141134934) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 1-propan-2-yloxyindazole.
Molecular Properties
| Compound Name | 1-propan-2-yloxyindazole |
| PubChem CID | 141134934 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 1-propan-2-yloxyindazole |
| SMILES | CC(C)On1ncc2ccccc21 |
| InChI | InChI=1S/C10H12N2O/c1-8(2)13-12-10-6-4-3-5-9(10)7-11-12/h3-8H,1-2H3 |
| InChIKey | XBHQOTBQNDAVCE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-propan-2-yloxyindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yloxyindazole?
The IUPAC name of 1-propan-2-yloxyindazole (CID 141134934) is 1-propan-2-yloxyindazole.
What is the SMILES notation for 1-propan-2-yloxyindazole?
The canonical SMILES for 1-propan-2-yloxyindazole is CC(C)On1ncc2ccccc21.
What is the InChIKey of 1-propan-2-yloxyindazole?
The InChIKey is XBHQOTBQNDAVCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c1-8(2)13-12-10-6-4-3-5-9(10)7-11-12/h3-8H,1-2H3.
What are the key properties of 1-propan-2-yloxyindazole?
1-propan-2-yloxyindazole has a molecular weight of 176.22 g/mol, XLogP of 1.87, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yloxyindazole is sourced from PubChem (CID 141134934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).