About 4-[3-(2,6-difluorophenoxy)propyl]-1,3-thiazole
4-[3-(2,6-difluorophenoxy)propyl]-1,3-thiazole (PubChem CID 141135135) has the molecular formula C12H11F2NOS
and a molecular weight of 255.29 g/mol. Its IUPAC name is 4-[3-(2,6-difluorophenoxy)propyl]-1,3-thiazole.
Molecular Properties
| Compound Name | 4-[3-(2,6-difluorophenoxy)propyl]-1,3-thiazole |
| PubChem CID | 141135135 |
| Molecular Formula | C12H11F2NOS |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 4-[3-(2,6-difluorophenoxy)propyl]-1,3-thiazole |
| SMILES | Fc1cccc(F)c1OCCCc1cscn1 |
| InChI | InChI=1S/C12H11F2NOS/c13-10-4-1-5-11(14)12(10)16-6-2-3-9-7-17-8-15-9/h1,4-5,7-8H,2-3,6H2 |
| InChIKey | VWGUTAPOKPZGBD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(2,6-difluorophenoxy)propyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2,6-difluorophenoxy)propyl]-1,3-thiazole?
The IUPAC name of 4-[3-(2,6-difluorophenoxy)propyl]-1,3-thiazole (CID 141135135) is 4-[3-(2,6-difluorophenoxy)propyl]-1,3-thiazole.
What is the SMILES notation for 4-[3-(2,6-difluorophenoxy)propyl]-1,3-thiazole?
The canonical SMILES for 4-[3-(2,6-difluorophenoxy)propyl]-1,3-thiazole is Fc1cccc(F)c1OCCCc1cscn1.
What is the InChIKey of 4-[3-(2,6-difluorophenoxy)propyl]-1,3-thiazole?
The InChIKey is VWGUTAPOKPZGBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F2NOS/c13-10-4-1-5-11(14)12(10)16-6-2-3-9-7-17-8-15-9/h1,4-5,7-8H,2-3,6H2.
What are the key properties of 4-[3-(2,6-difluorophenoxy)propyl]-1,3-thiazole?
4-[3-(2,6-difluorophenoxy)propyl]-1,3-thiazole has a molecular weight of 255.29 g/mol, XLogP of 3.43, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2,6-difluorophenoxy)propyl]-1,3-thiazole is sourced from PubChem (CID 141135135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).