C10H12F3NO3 — CID 141135261
ethyl 2-[5-(hydroxymethyl)-4-(trifluoromethyl)-1H-pyrrol-2-yl]acetate (PubChem CID 141135261) has the molecular formula C10H12F3NO3 and a molecular weight of 251.20 g/mol. Its IUPAC name is ethyl 2-[5-(hydroxymethyl)-4-(trifluoromethyl)-1H-pyrrol-2-yl]acetate.
| Compound Name | ethyl 2-[5-(hydroxymethyl)-4-(trifluoromethyl)-1H-pyrrol-2-yl]acetate |
|---|---|
| PubChem CID | 141135261 |
| Molecular Formula | C10H12F3NO3 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | ethyl 2-[5-(hydroxymethyl)-4-(trifluoromethyl)-1H-pyrrol-2-yl]acetate |
| SMILES | CCOC(=O)Cc1cc(C(F)(F)F)c(CO)[nH]1 |
| InChI | InChI=1S/C10H12F3NO3/c1-2-17-9(16)4-6-3-7(10(11,12)13)8(5-15)14-6/h3,14-15H,2,4-5H2,1H3 |
| InChIKey | LJJHSHOIVTULAI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |