C18H38N2O2 — CID 141135323
4-(3,5-diaminododecoxy)cyclohexan-1-ol (PubChem CID 141135323) has the molecular formula C18H38N2O2 and a molecular weight of 314.51 g/mol. Its IUPAC name is 4-(3,5-diaminododecoxy)cyclohexan-1-ol.
| Compound Name | 4-(3,5-diaminododecoxy)cyclohexan-1-ol |
|---|---|
| PubChem CID | 141135323 |
| Molecular Formula | C18H38N2O2 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.29 |
| IUPAC Name | 4-(3,5-diaminododecoxy)cyclohexan-1-ol |
| SMILES | CCCCCCCC(N)CC(N)CCOC1CCC(O)CC1 |
| InChI | InChI=1S/C18H38N2O2/c1-2-3-4-5-6-7-15(19)14-16(20)12-13-22-18-10-8-17(21)9-11-18/h15-18,21H,2-14,19-20H2,1H3 |
| InChIKey | MWKSKKCYOCDGMD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|