About N,3-dimethylpyrrol-3-amine
N,3-dimethylpyrrol-3-amine (PubChem CID 141135416) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is N,3-dimethylpyrrol-3-amine.
Molecular Properties
| Compound Name | N,3-dimethylpyrrol-3-amine |
| PubChem CID | 141135416 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | N,3-dimethylpyrrol-3-amine |
| SMILES | CNC1(C)C=CN=C1 |
| InChI | InChI=1S/C6H10N2/c1-6(7-2)3-4-8-5-6/h3-5,7H,1-2H3 |
| InChIKey | BPVKWMGWZGZBJT-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,3-dimethylpyrrol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dimethylpyrrol-3-amine?
The IUPAC name of N,3-dimethylpyrrol-3-amine (CID 141135416) is N,3-dimethylpyrrol-3-amine.
What is the SMILES notation for N,3-dimethylpyrrol-3-amine?
The canonical SMILES for N,3-dimethylpyrrol-3-amine is CNC1(C)C=CN=C1.
What is the InChIKey of N,3-dimethylpyrrol-3-amine?
The InChIKey is BPVKWMGWZGZBJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2/c1-6(7-2)3-4-8-5-6/h3-5,7H,1-2H3.
What are the key properties of N,3-dimethylpyrrol-3-amine?
N,3-dimethylpyrrol-3-amine has a molecular weight of 110.16 g/mol, XLogP of 0.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dimethylpyrrol-3-amine is sourced from PubChem (CID 141135416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).