About 2,3-dibromoindol-1-amine
2,3-dibromoindol-1-amine (PubChem CID 141135637) has the molecular formula C8H6Br2N2
and a molecular weight of 289.96 g/mol. Its IUPAC name is 2,3-dibromoindol-1-amine.
Molecular Properties
| Compound Name | 2,3-dibromoindol-1-amine |
| PubChem CID | 141135637 |
| Molecular Formula | C8H6Br2N2 |
| Molecular Weight | 289.96 g/mol |
| Exact Mass | 287.89 |
| IUPAC Name | 2,3-dibromoindol-1-amine |
| SMILES | Nn1c(Br)c(Br)c2ccccc21 |
| InChI | InChI=1S/C8H6Br2N2/c9-7-5-3-1-2-4-6(5)12(11)8(7)10/h1-4H,11H2 |
| InChIKey | AHBSSXHHULBOKB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.96 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dibromoindol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibromoindol-1-amine?
The IUPAC name of 2,3-dibromoindol-1-amine (CID 141135637) is 2,3-dibromoindol-1-amine.
What is the SMILES notation for 2,3-dibromoindol-1-amine?
The canonical SMILES for 2,3-dibromoindol-1-amine is Nn1c(Br)c(Br)c2ccccc21.
What is the InChIKey of 2,3-dibromoindol-1-amine?
The InChIKey is AHBSSXHHULBOKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Br2N2/c9-7-5-3-1-2-4-6(5)12(11)8(7)10/h1-4H,11H2.
What are the key properties of 2,3-dibromoindol-1-amine?
2,3-dibromoindol-1-amine has a molecular weight of 289.96 g/mol, XLogP of 2.88, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibromoindol-1-amine is sourced from PubChem (CID 141135637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).