About 3-amino-1-[bis(carboxymethyl)amino]cyclohexa-2,4-diene-1-carboxylic acid
3-amino-1-[bis(carboxymethyl)amino]cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 141136208) has the molecular formula C11H14N2O6
and a molecular weight of 270.24 g/mol. Its IUPAC name is 3-amino-1-[bis(carboxymethyl)amino]cyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-amino-1-[bis(carboxymethyl)amino]cyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 141136208 |
| Molecular Formula | C11H14N2O6 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 3-amino-1-[bis(carboxymethyl)amino]cyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | NC1=CC(C(=O)O)(N(CC(=O)O)CC(=O)O)CC=C1 |
| InChI | InChI=1S/C11H14N2O6/c12-7-2-1-3-11(4-7,10(18)19)13(5-8(14)15)6-9(16)17/h1-2,4H,3,5-6,12H2,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | AJDBLTBAEFKASV-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 141.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-1-[bis(carboxymethyl)amino]cyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-[bis(carboxymethyl)amino]cyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 3-amino-1-[bis(carboxymethyl)amino]cyclohexa-2,4-diene-1-carboxylic acid (CID 141136208) is 3-amino-1-[bis(carboxymethyl)amino]cyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 3-amino-1-[bis(carboxymethyl)amino]cyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 3-amino-1-[bis(carboxymethyl)amino]cyclohexa-2,4-diene-1-carboxylic acid is NC1=CC(C(=O)O)(N(CC(=O)O)CC(=O)O)CC=C1.
What is the InChIKey of 3-amino-1-[bis(carboxymethyl)amino]cyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is AJDBLTBAEFKASV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O6/c12-7-2-1-3-11(4-7,10(18)19)13(5-8(14)15)6-9(16)17/h1-2,4H,3,5-6,12H2,(H,14,15)(H,16,17)(H,18,19).
What are the key properties of 3-amino-1-[bis(carboxymethyl)amino]cyclohexa-2,4-diene-1-carboxylic acid?
3-amino-1-[bis(carboxymethyl)amino]cyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 270.24 g/mol, XLogP of -0.92, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-[bis(carboxymethyl)amino]cyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 141136208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).