About 5-hexyl-1H-pyrrol-2-ol;hydrate
5-hexyl-1H-pyrrol-2-ol;hydrate (PubChem CID 141136224) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is 5-hexyl-1H-pyrrol-2-ol;hydrate.
Molecular Properties
| Compound Name | 5-hexyl-1H-pyrrol-2-ol;hydrate |
| PubChem CID | 141136224 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 5-hexyl-1H-pyrrol-2-ol;hydrate |
| SMILES | CCCCCCc1ccc(O)[nH]1.O |
| InChI | InChI=1S/C10H17NO.H2O/c1-2-3-4-5-6-9-7-8-10(12)11-9;/h7-8,11-12H,2-6H2,1H3;1H2 |
| InChIKey | SNZODRFWMIHIFO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 67.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-hexyl-1H-pyrrol-2-ol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hexyl-1H-pyrrol-2-ol;hydrate?
The IUPAC name of 5-hexyl-1H-pyrrol-2-ol;hydrate (CID 141136224) is 5-hexyl-1H-pyrrol-2-ol;hydrate.
What is the SMILES notation for 5-hexyl-1H-pyrrol-2-ol;hydrate?
The canonical SMILES for 5-hexyl-1H-pyrrol-2-ol;hydrate is CCCCCCc1ccc(O)[nH]1.O.
What is the InChIKey of 5-hexyl-1H-pyrrol-2-ol;hydrate?
The InChIKey is SNZODRFWMIHIFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO.H2O/c1-2-3-4-5-6-9-7-8-10(12)11-9;/h7-8,11-12H,2-6H2,1H3;1H2.
What are the key properties of 5-hexyl-1H-pyrrol-2-ol;hydrate?
5-hexyl-1H-pyrrol-2-ol;hydrate has a molecular weight of 185.27 g/mol, XLogP of 2.02, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hexyl-1H-pyrrol-2-ol;hydrate is sourced from PubChem (CID 141136224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).