C20H33NO10 — CID 141136365
(2S)-2-[bis[(1-deuterio-2-methylpropan-2-yl)oxycarbonyl]amino]-2-(1-deuterio-2-methylpropan-2-yl)oxycarbonylpentanedioic acid (PubChem CID 141136365) has the molecular formula C20H33NO10 and a molecular weight of 450.50 g/mol. Its IUPAC name is (2S)-2-[bis[(1-deuterio-2-methylpropan-2-yl)oxycarbonyl]amino]-2-(1-deuterio-2-methylpropan-2-yl)oxycarbonylpentanedioic acid.
| Compound Name | (2S)-2-[bis[(1-deuterio-2-methylpropan-2-yl)oxycarbonyl]amino]-2-(1-deuterio-2-methylpropan-2-yl)oxycarbonylpentanedioic acid |
|---|---|
| PubChem CID | 141136365 |
| Molecular Formula | C20H33NO10 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | (2S)-2-[bis[(1-deuterio-2-methylpropan-2-yl)oxycarbonyl]amino]-2-(1-deuterio-2-methylpropan-2-yl)oxycarbonylpentanedioic acid |
| SMILES | [2H]CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C[2H])[C@@](CCC(=O)O)(C(=O)O)C(=O)OC(C)(C)C[2H] |
| InChI | InChI=1S/C20H33NO10/c1-17(2,3)29-14(26)20(13(24)25,11-10-12(22)23)21(15(27)30-18(4,5)6)16(28)31-19(7,8)9/h10-11H2,1-9H3,(H,22,23)(H,24,25)/t20-/m0/s1/i1D,4D,7D |
| InChIKey | XGXCIIOOMYYIMF-UJJSIDGVSA-N |
| XLogP | 3.19 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|