C24H29FN2O3 — CID 141136654
2-[2-fluoro-7-[heptylcarbamoyl(methyl)amino]-4-phenyl-6-bicyclo[3.1.1]hepta-1,3,5(7)-trienyl]acetic acid (PubChem CID 141136654) has the molecular formula C24H29FN2O3 and a molecular weight of 412.51 g/mol. Its IUPAC name is 2-[2-fluoro-7-[heptylcarbamoyl(methyl)amino]-4-phenyl-6-bicyclo[3.1.1]hepta-1,3,5(7)-trienyl]acetic acid.
| Compound Name | 2-[2-fluoro-7-[heptylcarbamoyl(methyl)amino]-4-phenyl-6-bicyclo[3.1.1]hepta-1,3,5(7)-trienyl]acetic acid |
|---|---|
| PubChem CID | 141136654 |
| Molecular Formula | C24H29FN2O3 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 2-[2-fluoro-7-[heptylcarbamoyl(methyl)amino]-4-phenyl-6-bicyclo[3.1.1]hepta-1,3,5(7)-trienyl]acetic acid |
| SMILES | CCCCCCCNC(=O)N(C)c1c2c(F)cc(-c3ccccc3)c1C2CC(=O)O |
| InChI | InChI=1S/C24H29FN2O3/c1-3-4-5-6-10-13-26-24(30)27(2)23-21-17(16-11-8-7-9-12-16)14-19(25)22(23)18(21)15-20(28)29/h7-9,11-12,14,18H,3-6,10,13,15H2,1-2H3,(H,26,30)(H,28,29) |
| InChIKey | ORWRXNDSFRVEFO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|