C11H17NO2 — CID 141136777
methyl 2,3,4,4a,5,6-hexahydro-1H-isoquinoline-8a-carboxylate (PubChem CID 141136777) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is methyl 2,3,4,4a,5,6-hexahydro-1H-isoquinoline-8a-carboxylate.
| Compound Name | methyl 2,3,4,4a,5,6-hexahydro-1H-isoquinoline-8a-carboxylate |
|---|---|
| PubChem CID | 141136777 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | methyl 2,3,4,4a,5,6-hexahydro-1H-isoquinoline-8a-carboxylate |
| SMILES | COC(=O)C12C=CCCC1CCNC2 |
| InChI | InChI=1S/C11H17NO2/c1-14-10(13)11-6-3-2-4-9(11)5-7-12-8-11/h3,6,9,12H,2,4-5,7-8H2,1H3 |
| InChIKey | VPMRYYAFWHNXST-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|