About (5-methylpyrrolo[2,1-f][1,2,4]triazin-6-yl)methanol
(5-methylpyrrolo[2,1-f][1,2,4]triazin-6-yl)methanol (PubChem CID 141136816) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is (5-methylpyrrolo[2,1-f][1,2,4]triazin-6-yl)methanol.
Analyze (5-methylpyrrolo[2,1-f][1,2,4]triazin-6-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methylpyrrolo[2,1-f][1,2,4]triazin-6-yl)methanol?
The IUPAC name of (5-methylpyrrolo[2,1-f][1,2,4]triazin-6-yl)methanol (CID 141136816) is (5-methylpyrrolo[2,1-f][1,2,4]triazin-6-yl)methanol.
What is the SMILES notation for (5-methylpyrrolo[2,1-f][1,2,4]triazin-6-yl)methanol?
The canonical SMILES for (5-methylpyrrolo[2,1-f][1,2,4]triazin-6-yl)methanol is Cc1c(CO)cn2ncncc12.
What is the InChIKey of (5-methylpyrrolo[2,1-f][1,2,4]triazin-6-yl)methanol?
The InChIKey is DBLCSEKTBOWGKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-6-7(4-12)3-11-8(6)2-9-5-10-11/h2-3,5,12H,4H2,1H3.
What are the key properties of (5-methylpyrrolo[2,1-f][1,2,4]triazin-6-yl)methanol?
(5-methylpyrrolo[2,1-f][1,2,4]triazin-6-yl)methanol has a molecular weight of 163.18 g/mol, XLogP of 0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methylpyrrolo[2,1-f][1,2,4]triazin-6-yl)methanol is sourced from PubChem (CID 141136816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).