C18H17FN2O2 — CID 141136927
methyl N-[[4-[2-(2-amino-4-fluorophenyl)ethynyl]phenyl]methyl]-N-methylcarbamate (PubChem CID 141136927) has the molecular formula C18H17FN2O2 and a molecular weight of 312.34 g/mol. Its IUPAC name is methyl N-[[4-[2-(2-amino-4-fluorophenyl)ethynyl]phenyl]methyl]-N-methylcarbamate.
| Compound Name | methyl N-[[4-[2-(2-amino-4-fluorophenyl)ethynyl]phenyl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 141136927 |
| Molecular Formula | C18H17FN2O2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | methyl N-[[4-[2-(2-amino-4-fluorophenyl)ethynyl]phenyl]methyl]-N-methylcarbamate |
| SMILES | COC(=O)N(C)Cc1ccc(C#Cc2ccc(F)cc2N)cc1 |
| InChI | InChI=1S/C18H17FN2O2/c1-21(18(22)23-2)12-14-5-3-13(4-6-14)7-8-15-9-10-16(19)11-17(15)20/h3-6,9-11H,12,20H2,1-2H3 |
| InChIKey | PLHZJSYROLBDIQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|