C21H30ClN3O2 — CID 141138264
(2R)-2-[(1-acetylpiperidin-4-yl)amino]-3-(4-chlorophenyl)-1-piperidin-1-ylpropan-1-one (PubChem CID 141138264) has the molecular formula C21H30ClN3O2 and a molecular weight of 391.94 g/mol. Its IUPAC name is (2R)-2-[(1-acetylpiperidin-4-yl)amino]-3-(4-chlorophenyl)-1-piperidin-1-ylpropan-1-one.
| Compound Name | (2R)-2-[(1-acetylpiperidin-4-yl)amino]-3-(4-chlorophenyl)-1-piperidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 141138264 |
| Molecular Formula | C21H30ClN3O2 |
| Molecular Weight | 391.94 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | (2R)-2-[(1-acetylpiperidin-4-yl)amino]-3-(4-chlorophenyl)-1-piperidin-1-ylpropan-1-one |
| SMILES | CC(=O)N1CCC(N[C@H](Cc2ccc(Cl)cc2)C(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C21H30ClN3O2/c1-16(26)24-13-9-19(10-14-24)23-20(15-17-5-7-18(22)8-6-17)21(27)25-11-3-2-4-12-25/h5-8,19-20,23H,2-4,9-15H2,1H3/t20-/m1/s1 |
| InChIKey | JIWRLZACDMHING-HXUWFJFHSA-N |
| XLogP | 2.86 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.94 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |